C29H23O4P — CID 176914205
(3R)-4-(2-phenylphenoxy)phosphanyloxyspiro[1,2-dihydroindene-3,4'-3H-chromene]-2'-one (PubChem CID 176914205) has the molecular formula C29H23O4P and a molecular weight of 466.47 g/mol. Its IUPAC name is (3R)-4-(2-phenylphenoxy)phosphanyloxyspiro[1,2-dihydroindene-3,4'-3H-chromene]-2'-one.
| Compound Name | (3R)-4-(2-phenylphenoxy)phosphanyloxyspiro[1,2-dihydroindene-3,4'-3H-chromene]-2'-one |
|---|---|
| PubChem CID | 176914205 |
| Molecular Formula | C29H23O4P |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | (3R)-4-(2-phenylphenoxy)phosphanyloxyspiro[1,2-dihydroindene-3,4'-3H-chromene]-2'-one |
| SMILES | O=C1C[C@]2(CCc3cccc(OPOc4ccccc4-c4ccccc4)c32)c2ccccc2O1 |
| InChI | InChI=1S/C29H23O4P/c30-27-19-29(23-13-5-7-15-25(23)31-27)18-17-21-11-8-16-26(28(21)29)33-34-32-24-14-6-4-12-22(24)20-9-2-1-3-10-20/h1-16,34H,17-19H2/t29-/m1/s1 |
| InChIKey | WKWHDIZVDPPABM-GDLZYMKVSA-N |
| XLogP | 6.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|