C36H27N3O — CID 163752152
2-(9,9-dimethylxanthen-1-yl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 163752152) has the molecular formula C36H27N3O and a molecular weight of 517.63 g/mol. Its IUPAC name is 2-(9,9-dimethylxanthen-1-yl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(9,9-dimethylxanthen-1-yl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 163752152 |
| Molecular Formula | C36H27N3O |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | 2-(9,9-dimethylxanthen-1-yl)-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2Oc2cccc(-c3nc(-c4ccccc4)nc(-c4ccc(-c5ccccc5)cc4)n3)c21 |
| InChI | InChI=1S/C36H27N3O/c1-36(2)29-17-9-10-18-30(29)40-31-19-11-16-28(32(31)36)35-38-33(26-14-7-4-8-15-26)37-34(39-35)27-22-20-25(21-23-27)24-12-5-3-6-13-24/h3-23H,1-2H3 |
| InChIKey | LQXJOPSSEKSXHA-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |