C67H42N6O — CID 149001752
2-[6-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]spiro[fluorene-9,9'-xanthene]-1-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 149001752) has the molecular formula C67H42N6O and a molecular weight of 947.11 g/mol. Its IUPAC name is 2-[6-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]spiro[fluorene-9,9'-xanthene]-1-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[6-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]spiro[fluorene-9,9'-xanthene]-1-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 149001752 |
| Molecular Formula | C67H42N6O |
| Molecular Weight | 947.11 g/mol |
| Exact Mass | 946.34 |
| IUPAC Name | 2-[6-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]spiro[fluorene-9,9'-xanthene]-1-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccc5c(c4)-c4cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c4C54c5ccccc5Oc5ccccc54)n3)cc2)cc1 |
| InChI | InChI=1S/C67H42N6O/c1-5-18-43(19-6-1)45-32-36-49(37-33-45)63-69-64(50-38-34-46(35-39-50)44-20-7-2-8-21-44)71-65(70-63)51-40-41-55-54(42-51)52-26-17-27-53(60(52)67(55)56-28-13-15-30-58(56)74-59-31-16-14-29-57(59)67)66-72-61(47-22-9-3-10-23-47)68-62(73-66)48-24-11-4-12-25-48/h1-42H |
| InChIKey | PZUFTZGHVIGCEO-UHFFFAOYSA-N |
| XLogP | 15.86 |
| TPSA | 86.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.11 |
| LogP ≤ 5 | 15.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |