C48H29N5O2 — CID 153297911
2-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[fluorene-9,9'-xanthene]-3-yl]-5-phenyl-1,3,4-oxadiazole (PubChem CID 153297911) has the molecular formula C48H29N5O2 and a molecular weight of 707.79 g/mol. Its IUPAC name is 2-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[fluorene-9,9'-xanthene]-3-yl]-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[fluorene-9,9'-xanthene]-3-yl]-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 153297911 |
| Molecular Formula | C48H29N5O2 |
| Molecular Weight | 707.79 g/mol |
| Exact Mass | 707.23 |
| IUPAC Name | 2-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[fluorene-9,9'-xanthene]-3-yl]-5-phenyl-1,3,4-oxadiazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc4c3C3(c5ccccc5Oc5ccccc53)c3ccc(-c5nnc(-c6ccccc6)o5)cc3-4)n2)cc1 |
| InChI | InChI=1S/C48H29N5O2/c1-4-15-30(16-5-1)43-49-44(31-17-6-2-7-18-31)51-45(50-43)35-22-14-21-34-36-29-33(47-53-52-46(55-47)32-19-8-3-9-20-32)27-28-37(36)48(42(34)35)38-23-10-12-25-40(38)54-41-26-13-11-24-39(41)48/h1-29H |
| InChIKey | DCKPJUNEMAPNJR-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 86.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.79 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |