C18H18O3 — CID 125035077
(1R,10R,11R,14S)-11,14-dimethyl-16-oxatetracyclo[8.4.3.01,10.02,7]heptadeca-2,4,6,12-tetraene-15,17-dione (PubChem CID 125035077) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is (1R,10R,11R,14S)-11,14-dimethyl-16-oxatetracyclo[8.4.3.01,10.02,7]heptadeca-2,4,6,12-tetraene-15,17-dione.
| Compound Name | (1R,10R,11R,14S)-11,14-dimethyl-16-oxatetracyclo[8.4.3.01,10.02,7]heptadeca-2,4,6,12-tetraene-15,17-dione |
|---|---|
| PubChem CID | 125035077 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (1R,10R,11R,14S)-11,14-dimethyl-16-oxatetracyclo[8.4.3.01,10.02,7]heptadeca-2,4,6,12-tetraene-15,17-dione |
| SMILES | C[C@@H]1C=C[C@H](C)[C@]23C(=O)OC(=O)[C@]12CCc1ccccc13 |
| InChI | InChI=1S/C18H18O3/c1-11-7-8-12(2)18-14-6-4-3-5-13(14)9-10-17(11,18)15(19)21-16(18)20/h3-8,11-12H,9-10H2,1-2H3/t11-,12+,17+,18+/m1/s1 |
| InChIKey | NKYDTFPGUPBBDS-BVNNNZQISA-N |
| XLogP | 2.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|