C24H18O3 — CID 10641844
(2R,3S,6R,7S)-22-oxaheptacyclo[6.6.6.32,7.23,6.02,7.09,14.015,20]pentacosa-4,9,11,13,15,17,19-heptaene-21,23-dione (PubChem CID 10641844) has the molecular formula C24H18O3 and a molecular weight of 354.40 g/mol. Its IUPAC name is (2R,3S,6R,7S)-22-oxaheptacyclo[6.6.6.32,7.23,6.02,7.09,14.015,20]pentacosa-4,9,11,13,15,17,19-heptaene-21,23-dione.
| Compound Name | (2R,3S,6R,7S)-22-oxaheptacyclo[6.6.6.32,7.23,6.02,7.09,14.015,20]pentacosa-4,9,11,13,15,17,19-heptaene-21,23-dione |
|---|---|
| PubChem CID | 10641844 |
| Molecular Formula | C24H18O3 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | (2R,3S,6R,7S)-22-oxaheptacyclo[6.6.6.32,7.23,6.02,7.09,14.015,20]pentacosa-4,9,11,13,15,17,19-heptaene-21,23-dione |
| SMILES | O=C1OC(=O)[C@]23C4c5ccccc5C(c5ccccc54)[C@]12[C@H]1C=C[C@@H]3CC1 |
| InChI | InChI=1S/C24H18O3/c25-21-23-13-9-11-14(12-10-13)24(23,22(26)27-21)20-16-6-2-1-5-15(16)19(23)17-7-3-4-8-18(17)20/h1-9,11,13-14,19-20H,10,12H2/t13-,14+,19?,20?,23+,24- |
| InChIKey | HDSUHURYJKPKFL-UXVIXSOYSA-N |
| XLogP | 3.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|