C35H26Cl2O3 — CID 139114251
dichloromethane;(2R,3S,10R,11S)-5,8-dimethyl-26-oxanonacyclo[10.6.6.63,10.32,11.02,11.04,9.013,18.019,24.028,33]tritriaconta-4,6,8,13,15,17,19,21,23,28,30,32-dodecaene-25,27-dione (PubChem CID 139114251) has the molecular formula C35H26Cl2O3 and a molecular weight of 565.50 g/mol. Its IUPAC name is dichloromethane;(2R,3S,10R,11S)-5,8-dimethyl-26-oxanonacyclo[10.6.6.63,10.32,11.02,11.04,9.013,18.019,24.028,33]tritriaconta-4,6,8,13,15,17,19,21,23,28,30,32-dodecaene-25,27-dione.
| Compound Name | dichloromethane;(2R,3S,10R,11S)-5,8-dimethyl-26-oxanonacyclo[10.6.6.63,10.32,11.02,11.04,9.013,18.019,24.028,33]tritriaconta-4,6,8,13,15,17,19,21,23,28,30,32-dodecaene-25,27-dione |
|---|---|
| PubChem CID | 139114251 |
| Molecular Formula | C35H26Cl2O3 |
| Molecular Weight | 565.50 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | dichloromethane;(2R,3S,10R,11S)-5,8-dimethyl-26-oxanonacyclo[10.6.6.63,10.32,11.02,11.04,9.013,18.019,24.028,33]tritriaconta-4,6,8,13,15,17,19,21,23,28,30,32-dodecaene-25,27-dione |
| SMILES | Cc1ccc(C)c2c1[C@@H]1c3ccccc3[C@H]2[C@]23C(=O)OC(=O)[C@]12C1c2ccccc2C3c2ccccc21.ClCCl |
| InChI | InChI=1S/C34H24O3.CH2Cl2/c1-17-15-16-18(2)26-25(17)29-23-13-7-8-14-24(23)30(26)34-28-21-11-5-3-9-19(21)27(20-10-4-6-12-22(20)28)33(29,34)31(35)37-32(34)36;2-1-3/h3-16,27-30H,1-2H3;1H2/t27?,28?,29-,30+,33-,34+; |
| InChIKey | AYNYMBJGQBVZAX-ORCMMARDSA-N |
| XLogP | 7.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.50 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|