C16H14O5 — CID 132500466
(1'R,8'S,9'R,11'S)-2,2-dimethylspiro[1,3-dioxane-5,10'-12-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene]-4,6-dione (PubChem CID 132500466) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is (1'R,8'S,9'R,11'S)-2,2-dimethylspiro[1,3-dioxane-5,10'-12-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene]-4,6-dione.
| Compound Name | (1'R,8'S,9'R,11'S)-2,2-dimethylspiro[1,3-dioxane-5,10'-12-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene]-4,6-dione |
|---|---|
| PubChem CID | 132500466 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | (1'R,8'S,9'R,11'S)-2,2-dimethylspiro[1,3-dioxane-5,10'-12-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene]-4,6-dione |
| SMILES | CC1(C)OC(=O)C2(C(=O)O1)[C@@H]1[C@H]2[C@@H]2O[C@H]1c1ccccc12 |
| InChI | InChI=1S/C16H14O5/c1-15(2)20-13(17)16(14(18)21-15)9-10(16)12-8-6-4-3-5-7(8)11(9)19-12/h3-6,9-12H,1-2H3/t9-,10+,11+,12- |
| InChIKey | WUZPEIIMRNQFIU-IWDIQUIJSA-N |
| XLogP | 1.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cycloheptane_2', 'substructure': 'N/A'} |
|---|