C10H8O2 — CID 98543355
(1R,8R,9R,11R)-10,12-dioxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene (PubChem CID 98543355) has the molecular formula C10H8O2 and a molecular weight of 160.17 g/mol. Its IUPAC name is (1R,8R,9R,11R)-10,12-dioxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene.
| Compound Name | (1R,8R,9R,11R)-10,12-dioxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 98543355 |
| Molecular Formula | C10H8O2 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | (1R,8R,9R,11R)-10,12-dioxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene |
| SMILES | c1ccc2c(c1)[C@H]1O[C@H]2[C@H]2O[C@@H]21 |
| InChI | InChI=1S/C10H8O2/c1-2-4-6-5(3-1)7-9-10(12-9)8(6)11-7/h1-4,7-10H/t7-,8-,9-,10-/m1/s1 |
| InChIKey | GHPWZPHGHQJKDD-ZYUZMQFOSA-N |
| XLogP | 1.58 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|