C12H12O — CID 22216431
(9R,11S)-10-oxatetracyclo[6.3.2.02,7.09,11]trideca-2,4,6-triene (PubChem CID 22216431) has the molecular formula C12H12O and a molecular weight of 172.23 g/mol. Its IUPAC name is (9R,11S)-10-oxatetracyclo[6.3.2.02,7.09,11]trideca-2,4,6-triene.
| Compound Name | (9R,11S)-10-oxatetracyclo[6.3.2.02,7.09,11]trideca-2,4,6-triene |
|---|---|
| PubChem CID | 22216431 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | (9R,11S)-10-oxatetracyclo[6.3.2.02,7.09,11]trideca-2,4,6-triene |
| SMILES | c1ccc2c(c1)C1CCC2[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C12H12O/c1-2-4-8-7(3-1)9-5-6-10(8)12-11(9)13-12/h1-4,9-12H,5-6H2/t9?,10?,11-,12+ |
| InChIKey | MQADEVFZONLFOS-CAODYFQJSA-N |
| XLogP | 2.43 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|