C11H11Cl — CID 130699170
(1R,8S)-11-chlorotricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 130699170) has the molecular formula C11H11Cl and a molecular weight of 178.66 g/mol. Its IUPAC name is (1R,8S)-11-chlorotricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1R,8S)-11-chlorotricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 130699170 |
| Molecular Formula | C11H11Cl |
| Molecular Weight | 178.66 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | (1R,8S)-11-chlorotricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | ClC1[C@@H]2CC[C@H]1c1ccccc12 |
| InChI | InChI=1S/C11H11Cl/c12-11-9-5-6-10(11)8-4-2-1-3-7(8)9/h1-4,9-11H,5-6H2/t9-,10+,11? |
| InChIKey | QTHZXXZPWFSZTK-ZACCUICWSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.66 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|