C9H9ClO2 — CID 10511719
(1S,3S)-2-chloro-2,3-dihydro-1H-indene-1,3-diol (PubChem CID 10511719) has the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. Its IUPAC name is (1S,3S)-2-chloro-2,3-dihydro-1H-indene-1,3-diol.
| Compound Name | (1S,3S)-2-chloro-2,3-dihydro-1H-indene-1,3-diol |
|---|---|
| PubChem CID | 10511719 |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.62 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | (1S,3S)-2-chloro-2,3-dihydro-1H-indene-1,3-diol |
| SMILES | O[C@H]1c2ccccc2[C@H](O)C1Cl |
| InChI | InChI=1S/C9H9ClO2/c10-7-8(11)5-3-1-2-4-6(5)9(7)12/h1-4,7-9,11-12H/t8-,9-/m0/s1 |
| InChIKey | UVADYYYQAKJUIF-IUCAKERBSA-N |
| XLogP | 1.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.62 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|