C12H12O2 — CID 130147962
tricyclo[7.2.1.02,7]dodeca-2,4,6,10-tetraene-8,12-diol (PubChem CID 130147962) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is tricyclo[7.2.1.02,7]dodeca-2,4,6,10-tetraene-8,12-diol.
| Compound Name | tricyclo[7.2.1.02,7]dodeca-2,4,6,10-tetraene-8,12-diol |
|---|---|
| PubChem CID | 130147962 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | tricyclo[7.2.1.02,7]dodeca-2,4,6,10-tetraene-8,12-diol |
| SMILES | OC1c2ccccc2C2C=CC1C2O |
| InChI | InChI=1S/C12H12O2/c13-11-8-4-2-1-3-7(8)9-5-6-10(11)12(9)14/h1-6,9-14H |
| InChIKey | AQHZLMIZTJPRNW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|