C10H10Br2O2 — CID 12740385
(1R,2S,3S,4R)-2,3-dibromo-1,2,3,4-tetrahydronaphthalene-1,4-diol (PubChem CID 12740385) has the molecular formula C10H10Br2O2 and a molecular weight of 322.00 g/mol. Its IUPAC name is (1R,2S,3S,4R)-2,3-dibromo-1,2,3,4-tetrahydronaphthalene-1,4-diol.
| Compound Name | (1R,2S,3S,4R)-2,3-dibromo-1,2,3,4-tetrahydronaphthalene-1,4-diol |
|---|---|
| PubChem CID | 12740385 |
| Molecular Formula | C10H10Br2O2 |
| Molecular Weight | 322.00 g/mol |
| Exact Mass | 319.90 |
| IUPAC Name | (1R,2S,3S,4R)-2,3-dibromo-1,2,3,4-tetrahydronaphthalene-1,4-diol |
| SMILES | O[C@@H]1c2ccccc2[C@@H](O)[C@H](Br)[C@H]1Br |
| InChI | InChI=1S/C10H10Br2O2/c11-7-8(12)10(14)6-4-2-1-3-5(6)9(7)13/h1-4,7-10,13-14H/t7-,8-,9-,10-/m1/s1 |
| InChIKey | WYGPQEXBYBTNRW-ZYUZMQFOSA-N |
| XLogP | 2.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.00 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|