C15H16O2 — CID 100934391
(1R,2S,3R,10R,11R,12S)-tetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraene-3,10-diol (PubChem CID 100934391) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is (1R,2S,3R,10R,11R,12S)-tetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraene-3,10-diol.
| Compound Name | (1R,2S,3R,10R,11R,12S)-tetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraene-3,10-diol |
|---|---|
| PubChem CID | 100934391 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (1R,2S,3R,10R,11R,12S)-tetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraene-3,10-diol |
| SMILES | O[C@H]1c2ccccc2[C@H](O)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C15H16O2/c16-14-10-3-1-2-4-11(10)15(17)13-9-6-5-8(7-9)12(13)14/h1-6,8-9,12-17H,7H2/t8-,9+,12-,13+,14-,15-/m0/s1 |
| InChIKey | LYMXOOHQUGPBHH-BIZQKLPVSA-N |
| XLogP | 2.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|