C22H19NO — CID 177495909
[(1R,2R,3S,6R,7S,8S)-15-azapentacyclo[6.6.1.13,6.02,7.09,14]hexadeca-4,9,11,13-tetraen-15-yl]-phenylmethanone (PubChem CID 177495909) has the molecular formula C22H19NO and a molecular weight of 313.40 g/mol. Its IUPAC name is [(1R,2R,3S,6R,7S,8S)-15-azapentacyclo[6.6.1.13,6.02,7.09,14]hexadeca-4,9,11,13-tetraen-15-yl]-phenylmethanone.
| Compound Name | [(1R,2R,3S,6R,7S,8S)-15-azapentacyclo[6.6.1.13,6.02,7.09,14]hexadeca-4,9,11,13-tetraen-15-yl]-phenylmethanone |
|---|---|
| PubChem CID | 177495909 |
| Molecular Formula | C22H19NO |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | [(1R,2R,3S,6R,7S,8S)-15-azapentacyclo[6.6.1.13,6.02,7.09,14]hexadeca-4,9,11,13-tetraen-15-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1[C@@H]2c3ccccc3[C@H]1[C@H]1[C@@H]2[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C22H19NO/c24-22(13-6-2-1-3-7-13)23-20-16-8-4-5-9-17(16)21(23)19-15-11-10-14(12-15)18(19)20/h1-11,14-15,18-21H,12H2/t14-,15+,18-,19+,20+,21- |
| InChIKey | LZERAYZUBYNNAZ-SBZQLOFLSA-N |
| XLogP | 4.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|