C21H18O2 — CID 98136767
[(1R,2R,3S,4R)-3-benzoyl-2-bicyclo[2.2.1]hept-5-enyl]-phenylmethanone (PubChem CID 98136767) has the molecular formula C21H18O2 and a molecular weight of 302.37 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-3-benzoyl-2-bicyclo[2.2.1]hept-5-enyl]-phenylmethanone.
| Compound Name | [(1R,2R,3S,4R)-3-benzoyl-2-bicyclo[2.2.1]hept-5-enyl]-phenylmethanone |
|---|---|
| PubChem CID | 98136767 |
| Molecular Formula | C21H18O2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [(1R,2R,3S,4R)-3-benzoyl-2-bicyclo[2.2.1]hept-5-enyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@H](C(=O)c2ccccc2)[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C21H18O2/c22-20(14-7-3-1-4-8-14)18-16-11-12-17(13-16)19(18)21(23)15-9-5-2-6-10-15/h1-12,16-19H,13H2/t16-,17-,18-,19+/m0/s1 |
| InChIKey | KAFIRIBTVAQVNC-CADBVGFASA-N |
| XLogP | 4.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|