C25H28N2O2 — CID 101191099
(1R,2R,3R,4S)-2-N,3-N-bis(1-phenylethyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide (PubChem CID 101191099) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is (1R,2R,3R,4S)-2-N,3-N-bis(1-phenylethyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide.
| Compound Name | (1R,2R,3R,4S)-2-N,3-N-bis(1-phenylethyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
|---|---|
| PubChem CID | 101191099 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (1R,2R,3R,4S)-2-N,3-N-bis(1-phenylethyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
| SMILES | CC(NC(=O)[C@H]1[C@H](C(=O)NC(C)c2ccccc2)[C@H]2C=C[C@@H]1C2)c1ccccc1 |
| InChI | InChI=1S/C25H28N2O2/c1-16(18-9-5-3-6-10-18)26-24(28)22-20-13-14-21(15-20)23(22)25(29)27-17(2)19-11-7-4-8-12-19/h3-14,16-17,20-23H,15H2,1-2H3,(H,26,28)(H,27,29)/t16?,17?,20-,21+,22-,23-/m1/s1 |
| InChIKey | KQCGSCVAPQXRFY-DPCIRCCGSA-N |
| XLogP | 4.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|