C17H17Cl2NO3 — CID 45330660
3-[1-(3,4-dichlorophenyl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 45330660) has the molecular formula C17H17Cl2NO3 and a molecular weight of 354.23 g/mol. Its IUPAC name is 3-[1-(3,4-dichlorophenyl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 3-[1-(3,4-dichlorophenyl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 45330660 |
| Molecular Formula | C17H17Cl2NO3 |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 3-[1-(3,4-dichlorophenyl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CC(NC(=O)C1C2C=CC(C2)C1C(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2NO3/c1-8(9-4-5-12(18)13(19)7-9)20-16(21)14-10-2-3-11(6-10)15(14)17(22)23/h2-5,7-8,10-11,14-15H,6H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | ZAOJFMHHLLKZAL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|