C16H13F5O — CID 11602120
[(1R,2R,3R,4S)-3-(1,1,2,2,2-pentafluoroethyl)-2-bicyclo[2.2.1]hept-5-enyl]-phenylmethanone (PubChem CID 11602120) has the molecular formula C16H13F5O and a molecular weight of 316.27 g/mol. Its IUPAC name is [(1R,2R,3R,4S)-3-(1,1,2,2,2-pentafluoroethyl)-2-bicyclo[2.2.1]hept-5-enyl]-phenylmethanone.
| Compound Name | [(1R,2R,3R,4S)-3-(1,1,2,2,2-pentafluoroethyl)-2-bicyclo[2.2.1]hept-5-enyl]-phenylmethanone |
|---|---|
| PubChem CID | 11602120 |
| Molecular Formula | C16H13F5O |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | [(1R,2R,3R,4S)-3-(1,1,2,2,2-pentafluoroethyl)-2-bicyclo[2.2.1]hept-5-enyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@H]1[C@H](C(F)(F)C(F)(F)F)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C16H13F5O/c17-15(18,16(19,20)21)13-11-7-6-10(8-11)12(13)14(22)9-4-2-1-3-5-9/h1-7,10-13H,8H2/t10-,11+,12+,13+/m0/s1 |
| InChIKey | STDYJLLDONDZRP-UMSGYPCISA-N |
| XLogP | 4.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|