About (1R,4S)-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene
(1R,4S)-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 15837042) has the molecular formula C9H8F6
and a molecular weight of 230.15 g/mol. Its IUPAC name is (1R,4S)-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | (1R,4S)-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene |
| PubChem CID | 15837042 |
| Molecular Formula | C9H8F6 |
| Molecular Weight | 230.15 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | (1R,4S)-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | FC(F)(F)C1C(C(F)(F)F)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C9H8F6/c10-8(11,12)6-4-1-2-5(3-4)7(6)9(13,14)15/h1-2,4-7H,3H2/t4-,5+,6?,7? |
| InChIKey | ZGNJHKOQQSEQRR-DPTVFECHSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.15 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R,4S)-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,4S)-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene?
The IUPAC name of (1R,4S)-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene (CID 15837042) is (1R,4S)-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for (1R,4S)-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene?
The canonical SMILES for (1R,4S)-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene is FC(F)(F)C1C(C(F)(F)F)[C@H]2C=C[C@@H]1C2.
What is the InChIKey of (1R,4S)-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene?
The InChIKey is ZGNJHKOQQSEQRR-DPTVFECHSA-N. The full InChI is InChI=1S/C9H8F6/c10-8(11,12)6-4-1-2-5(3-4)7(6)9(13,14)15/h1-2,4-7H,3H2/t4-,5+,6?,7?.
What are the key properties of (1R,4S)-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene?
(1R,4S)-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene has a molecular weight of 230.15 g/mol, XLogP of 3.55, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,4S)-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 15837042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).