C11H20 — CID 90928180
5,6-dimethylbicyclo[2.2.1]hept-2-ene;ethane (PubChem CID 90928180) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is 5,6-dimethylbicyclo[2.2.1]hept-2-ene;ethane.
| Compound Name | 5,6-dimethylbicyclo[2.2.1]hept-2-ene;ethane |
|---|---|
| PubChem CID | 90928180 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | 5,6-dimethylbicyclo[2.2.1]hept-2-ene;ethane |
| SMILES | CC.CC1C2C=CC(C2)C1C |
| InChI | InChI=1S/C9H14.C2H6/c1-6-7(2)9-4-3-8(6)5-9;1-2/h3-4,6-9H,5H2,1-2H3;1-2H3 |
| InChIKey | UPQTYKMYNIKMGE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|