C11H8F6O4 — CID 22172266
bis(trifluoromethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 22172266) has the molecular formula C11H8F6O4 and a molecular weight of 318.17 g/mol. Its IUPAC name is bis(trifluoromethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | bis(trifluoromethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 22172266 |
| Molecular Formula | C11H8F6O4 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | bis(trifluoromethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | O=C(OC(F)(F)F)C1C2C=CC(C2)C1C(=O)OC(F)(F)F |
| InChI | InChI=1S/C11H8F6O4/c12-10(13,14)20-8(18)6-4-1-2-5(3-4)7(6)9(19)21-11(15,16)17/h1-2,4-7H,3H2 |
| InChIKey | QQSLUAPRKAQNEG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|