C15H26O4Si2 — CID 101435000
bis(trimethylsilyl) (2S,3S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 101435000) has the molecular formula C15H26O4Si2 and a molecular weight of 326.54 g/mol. Its IUPAC name is bis(trimethylsilyl) (2S,3S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | bis(trimethylsilyl) (2S,3S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 101435000 |
| Molecular Formula | C15H26O4Si2 |
| Molecular Weight | 326.54 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | bis(trimethylsilyl) (2S,3S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | C[Si](C)(C)OC(=O)[C@H]1C2C=CC(C2)[C@@H]1C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C15H26O4Si2/c1-20(2,3)18-14(16)12-10-7-8-11(9-10)13(12)15(17)19-21(4,5)6/h7-8,10-13H,9H2,1-6H3/t10?,11?,12-,13-/m0/s1 |
| InChIKey | BODJRZJUEKKQIW-TYUFSLCMSA-N |
| XLogP | 3.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|