C9H8Cl2O2 — CID 13163688
(2R,3R)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl chloride (PubChem CID 13163688) has the molecular formula C9H8Cl2O2 and a molecular weight of 219.07 g/mol. Its IUPAC name is (2R,3R)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl chloride.
| Compound Name | (2R,3R)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl chloride |
|---|---|
| PubChem CID | 13163688 |
| Molecular Formula | C9H8Cl2O2 |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | (2R,3R)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl chloride |
| SMILES | O=C(Cl)[C@@H]1C2C=CC(C2)[C@H]1C(=O)Cl |
| InChI | InChI=1S/C9H8Cl2O2/c10-8(12)6-4-1-2-5(3-4)7(6)9(11)13/h1-2,4-7H,3H2/t4?,5?,6-,7-/m1/s1 |
| InChIKey | KANQIAARVSWKKG-TVVDDFTJSA-N |
| XLogP | 1.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|