C11H18O2Si — CID 14391647
trimethylsilyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 14391647) has the molecular formula C11H18O2Si and a molecular weight of 210.35 g/mol. Its IUPAC name is trimethylsilyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | trimethylsilyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 14391647 |
| Molecular Formula | C11H18O2Si |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | trimethylsilyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | C[Si](C)(C)OC(=O)C1CC2C=CC1C2 |
| InChI | InChI=1S/C11H18O2Si/c1-14(2,3)13-11(12)10-7-8-4-5-9(10)6-8/h4-5,8-10H,6-7H2,1-3H3 |
| InChIKey | YDOFALGSXSUFFA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|