C14H9F5O2 — CID 53260987
(2,3,4,5,6-pentafluorophenyl) (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 53260987) has the molecular formula C14H9F5O2 and a molecular weight of 304.21 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 53260987 |
| Molecular Formula | C14H9F5O2 |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)[C@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C14H9F5O2/c15-8-9(16)11(18)13(12(19)10(8)17)21-14(20)7-4-5-1-2-6(7)3-5/h1-2,5-7H,3-4H2/t5-,6+,7+/m1/s1 |
| InChIKey | ZOMLSPYVIOEUOQ-VQVTYTSYSA-N |
| XLogP | 3.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|