C14H14O2 — CID 100947460
phenyl (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 100947460) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is phenyl (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | phenyl (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 100947460 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | phenyl (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(Oc1ccccc1)[C@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C14H14O2/c15-14(16-12-4-2-1-3-5-12)13-9-10-6-7-11(13)8-10/h1-7,10-11,13H,8-9H2/t10-,11+,13+/m1/s1 |
| InChIKey | WLVPQQDEYVVXJF-MDZLAQPJSA-N |
| XLogP | 2.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|