C17H20O2 — CID 162701201
2-phenylpropan-2-yl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 162701201) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 2-phenylpropan-2-yl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 2-phenylpropan-2-yl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 162701201 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 2-phenylpropan-2-yl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(C)(OC(=O)C1CC2C=CC1C2)c1ccccc1 |
| InChI | InChI=1S/C17H20O2/c1-17(2,14-6-4-3-5-7-14)19-16(18)15-11-12-8-9-13(15)10-12/h3-9,12-13,15H,10-11H2,1-2H3 |
| InChIKey | BNLJTCKFLRZIJP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|