C12H18O4 — CID 11831113
(1,3-dihydroxy-2-methylpropan-2-yl) (1S,2S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 11831113) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (1,3-dihydroxy-2-methylpropan-2-yl) (1S,2S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1,3-dihydroxy-2-methylpropan-2-yl) (1S,2S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 11831113 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (1,3-dihydroxy-2-methylpropan-2-yl) (1S,2S,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(CO)(CO)OC(=O)[C@H]1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C12H18O4/c1-12(6-13,7-14)16-11(15)10-5-8-2-3-9(10)4-8/h2-3,8-10,13-14H,4-7H2,1H3/t8-,9+,10-/m0/s1 |
| InChIKey | OMVVARCMHWJDPQ-AEJSXWLSSA-N |
| XLogP | 0.49 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|