C31H32O4 — CID 21273715
[4-[2-[4-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)phenyl]propan-2-yl]phenyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 21273715) has the molecular formula C31H32O4 and a molecular weight of 468.59 g/mol. Its IUPAC name is [4-[2-[4-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)phenyl]propan-2-yl]phenyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [4-[2-[4-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)phenyl]propan-2-yl]phenyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 21273715 |
| Molecular Formula | C31H32O4 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | [4-[2-[4-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)phenyl]propan-2-yl]phenyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(C)(c1ccc(OC(=O)C2CC3C=CC2C3)cc1)c1ccc(OC(=O)C2CC3C=CC2C3)cc1 |
| InChI | InChI=1S/C31H32O4/c1-31(2,23-7-11-25(12-8-23)34-29(32)27-17-19-3-5-21(27)15-19)24-9-13-26(14-10-24)35-30(33)28-18-20-4-6-22(28)16-20/h3-14,19-22,27-28H,15-18H2,1-2H3 |
| InChIKey | MJGWRJLMTGEDCV-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|