C17H14O4 — CID 122218105
(2-oxochromen-7-yl) (2S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 122218105) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is (2-oxochromen-7-yl) (2S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (2-oxochromen-7-yl) (2S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 122218105 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (2-oxochromen-7-yl) (2S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(Oc1ccc2ccc(=O)oc2c1)[C@H]1CC2C=CC1C2 |
| InChI | InChI=1S/C17H14O4/c18-16-6-4-11-3-5-13(9-15(11)21-16)20-17(19)14-8-10-1-2-12(14)7-10/h1-6,9-10,12,14H,7-8H2/t10?,12?,14-/m0/s1 |
| InChIKey | KZRFGOMERUNJPF-OVGLSYRBSA-N |
| XLogP | 2.91 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|