About (2-oxochromen-7-yl) morpholine-4-carboxylate
(2-oxochromen-7-yl) morpholine-4-carboxylate (PubChem CID 847634) has the molecular formula C14H13NO5
and a molecular weight of 275.26 g/mol. Its IUPAC name is (2-oxochromen-7-yl) morpholine-4-carboxylate.
Molecular Properties
| Compound Name | (2-oxochromen-7-yl) morpholine-4-carboxylate |
| PubChem CID | 847634 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | (2-oxochromen-7-yl) morpholine-4-carboxylate |
| SMILES | O=C(Oc1ccc2ccc(=O)oc2c1)N1CCOCC1 |
| InChI | InChI=1S/C14H13NO5/c16-13-4-2-10-1-3-11(9-12(10)20-13)19-14(17)15-5-7-18-8-6-15/h1-4,9H,5-8H2 |
| InChIKey | RVTNPEHZVAYPOE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze (2-oxochromen-7-yl) morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxochromen-7-yl) morpholine-4-carboxylate?
The IUPAC name of (2-oxochromen-7-yl) morpholine-4-carboxylate (CID 847634) is (2-oxochromen-7-yl) morpholine-4-carboxylate.
What is the SMILES notation for (2-oxochromen-7-yl) morpholine-4-carboxylate?
The canonical SMILES for (2-oxochromen-7-yl) morpholine-4-carboxylate is O=C(Oc1ccc2ccc(=O)oc2c1)N1CCOCC1.
What is the InChIKey of (2-oxochromen-7-yl) morpholine-4-carboxylate?
The InChIKey is RVTNPEHZVAYPOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO5/c16-13-4-2-10-1-3-11(9-12(10)20-13)19-14(17)15-5-7-18-8-6-15/h1-4,9H,5-8H2.
What are the key properties of (2-oxochromen-7-yl) morpholine-4-carboxylate?
(2-oxochromen-7-yl) morpholine-4-carboxylate has a molecular weight of 275.26 g/mol, XLogP of 1.62, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxochromen-7-yl) morpholine-4-carboxylate is sourced from PubChem (CID 847634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).