C22H30N2O5 — CID 55550585
N-(3-ethyl-2-morpholin-4-ylpentyl)-2-(2-oxochromen-7-yl)oxyacetamide (PubChem CID 55550585) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is N-(3-ethyl-2-morpholin-4-ylpentyl)-2-(2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-2-(2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 55550585 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-2-(2-oxochromen-7-yl)oxyacetamide |
| SMILES | CCC(CC)C(CNC(=O)COc1ccc2ccc(=O)oc2c1)N1CCOCC1 |
| InChI | InChI=1S/C22H30N2O5/c1-3-16(4-2)19(24-9-11-27-12-10-24)14-23-21(25)15-28-18-7-5-17-6-8-22(26)29-20(17)13-18/h5-8,13,16,19H,3-4,9-12,14-15H2,1-2H3,(H,23,25) |
| InChIKey | JDSYFOCXPJNVFA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|