C17H22ClN3O4 — CID 119447724
2-(2-oxochromen-7-yl)oxy-N-(2-piperazin-1-ylethyl)acetamide;hydrochloride (PubChem CID 119447724) has the molecular formula C17H22ClN3O4 and a molecular weight of 367.83 g/mol. Its IUPAC name is 2-(2-oxochromen-7-yl)oxy-N-(2-piperazin-1-ylethyl)acetamide;hydrochloride.
| Compound Name | 2-(2-oxochromen-7-yl)oxy-N-(2-piperazin-1-ylethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119447724 |
| Molecular Formula | C17H22ClN3O4 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-(2-oxochromen-7-yl)oxy-N-(2-piperazin-1-ylethyl)acetamide;hydrochloride |
| SMILES | Cl.O=C(COc1ccc2ccc(=O)oc2c1)NCCN1CCNCC1 |
| InChI | InChI=1S/C17H21N3O4.ClH/c21-16(19-7-10-20-8-5-18-6-9-20)12-23-14-3-1-13-2-4-17(22)24-15(13)11-14;/h1-4,11,18H,5-10,12H2,(H,19,21);1H |
| InChIKey | DGWICHTZEROQPY-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|