C16H19ClN2O4 — CID 119427483
2-(2-oxochromen-7-yl)oxy-N-piperidin-3-ylacetamide;hydrochloride (PubChem CID 119427483) has the molecular formula C16H19ClN2O4 and a molecular weight of 338.79 g/mol. Its IUPAC name is 2-(2-oxochromen-7-yl)oxy-N-piperidin-3-ylacetamide;hydrochloride.
| Compound Name | 2-(2-oxochromen-7-yl)oxy-N-piperidin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119427483 |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 2-(2-oxochromen-7-yl)oxy-N-piperidin-3-ylacetamide;hydrochloride |
| SMILES | Cl.O=C(COc1ccc2ccc(=O)oc2c1)NC1CCCNC1 |
| InChI | InChI=1S/C16H18N2O4.ClH/c19-15(18-12-2-1-7-17-9-12)10-21-13-5-3-11-4-6-16(20)22-14(11)8-13;/h3-6,8,12,17H,1-2,7,9-10H2,(H,18,19);1H |
| InChIKey | YCDQQUUKWADTQI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|