C23H20N2O4 — CID 22720384
7-[2-oxo-2-(2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,7-a]indol-11-yl)ethoxy]chromen-2-one (PubChem CID 22720384) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is 7-[2-oxo-2-(2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,7-a]indol-11-yl)ethoxy]chromen-2-one.
| Compound Name | 7-[2-oxo-2-(2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,7-a]indol-11-yl)ethoxy]chromen-2-one |
|---|---|
| PubChem CID | 22720384 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 7-[2-oxo-2-(2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,7-a]indol-11-yl)ethoxy]chromen-2-one |
| SMILES | O=C(COc1ccc2ccc(=O)oc2c1)c1c2n(c3ccccc13)CCNCC2 |
| InChI | InChI=1S/C23H20N2O4/c26-20(14-28-16-7-5-15-6-8-22(27)29-21(15)13-16)23-17-3-1-2-4-18(17)25-12-11-24-10-9-19(23)25/h1-8,13,24H,9-12,14H2 |
| InChIKey | ZEVVYSGOLHAUDR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|