C20H19N3O4 — CID 22720807
2-(3-nitrophenoxy)-1-(2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,7-a]indol-11-yl)ethanone (PubChem CID 22720807) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is 2-(3-nitrophenoxy)-1-(2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,7-a]indol-11-yl)ethanone.
| Compound Name | 2-(3-nitrophenoxy)-1-(2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,7-a]indol-11-yl)ethanone |
|---|---|
| PubChem CID | 22720807 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-(3-nitrophenoxy)-1-(2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,7-a]indol-11-yl)ethanone |
| SMILES | O=C(COc1cccc([N+](=O)[O-])c1)c1c2n(c3ccccc13)CCNCC2 |
| InChI | InChI=1S/C20H19N3O4/c24-19(13-27-15-5-3-4-14(12-15)23(25)26)20-16-6-1-2-7-17(16)22-11-10-21-9-8-18(20)22/h1-7,12,21H,8-11,13H2 |
| InChIKey | ICSDOXZXOIHMPN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 86.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|