C19H14N2O4S — CID 46562426
N-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(2-oxochromen-7-yl)oxyacetamide (PubChem CID 46562426) has the molecular formula C19H14N2O4S and a molecular weight of 366.40 g/mol. Its IUPAC name is N-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 46562426 |
| Molecular Formula | C19H14N2O4S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | N-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(2-oxochromen-7-yl)oxyacetamide |
| SMILES | Cn1/c(=N/C(=O)COc2ccc3ccc(=O)oc3c2)sc2ccccc21 |
| InChI | InChI=1S/C19H14N2O4S/c1-21-14-4-2-3-5-16(14)26-19(21)20-17(22)11-24-13-8-6-12-7-9-18(23)25-15(12)10-13/h2-10H,11H2,1H3/b20-19- |
| InChIKey | MTLDAYASKZXTAY-VXPUYCOJSA-N |
| XLogP | 2.85 |
| TPSA | 73.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|