C20H16N2OS — CID 16849298
N-(3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-2-ylacetamide (PubChem CID 16849298) has the molecular formula C20H16N2OS and a molecular weight of 332.43 g/mol. Its IUPAC name is N-(3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-2-ylacetamide.
| Compound Name | N-(3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 16849298 |
| Molecular Formula | C20H16N2OS |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | N-(3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-2-ylacetamide |
| SMILES | Cn1/c(=N/C(=O)Cc2ccc3ccccc3c2)sc2ccccc21 |
| InChI | InChI=1S/C20H16N2OS/c1-22-17-8-4-5-9-18(17)24-20(22)21-19(23)13-14-10-11-15-6-2-3-7-16(15)12-14/h2-12H,13H2,1H3/b21-20- |
| InChIKey | VAKJRMJIAUKHMR-MRCUWXFGSA-N |
| XLogP | 4.06 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |