C16H24N4O3 — CID 119447721
2-[(2-phenoxyacetyl)amino]-N-(2-piperazin-1-ylethyl)acetamide (PubChem CID 119447721) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-[(2-phenoxyacetyl)amino]-N-(2-piperazin-1-ylethyl)acetamide.
| Compound Name | 2-[(2-phenoxyacetyl)amino]-N-(2-piperazin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 119447721 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2-[(2-phenoxyacetyl)amino]-N-(2-piperazin-1-ylethyl)acetamide |
| SMILES | O=C(CNC(=O)COc1ccccc1)NCCN1CCNCC1 |
| InChI | InChI=1S/C16H24N4O3/c21-15(18-8-11-20-9-6-17-7-10-20)12-19-16(22)13-23-14-4-2-1-3-5-14/h1-5,17H,6-13H2,(H,18,21)(H,19,22) |
| InChIKey | OHWCWWSDAWFGAA-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |