About (2-oxochromen-7-yl) hypoiodite
(2-oxochromen-7-yl) hypoiodite (PubChem CID 138751183) has the molecular formula C9H5IO3
and a molecular weight of 288.04 g/mol. Its IUPAC name is (2-oxochromen-7-yl) hypoiodite.
Molecular Properties
| Compound Name | (2-oxochromen-7-yl) hypoiodite |
| PubChem CID | 138751183 |
| Molecular Formula | C9H5IO3 |
| Molecular Weight | 288.04 g/mol |
| Exact Mass | 287.93 |
| IUPAC Name | (2-oxochromen-7-yl) hypoiodite |
| SMILES | O=c1ccc2ccc(OI)cc2o1 |
| InChI | InChI=1S/C9H5IO3/c10-13-7-3-1-6-2-4-9(11)12-8(6)5-7/h1-5H |
| InChIKey | XHRVUGUREXCJEE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.04 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-oxochromen-7-yl) hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxochromen-7-yl) hypoiodite?
The IUPAC name of (2-oxochromen-7-yl) hypoiodite (CID 138751183) is (2-oxochromen-7-yl) hypoiodite.
What is the SMILES notation for (2-oxochromen-7-yl) hypoiodite?
The canonical SMILES for (2-oxochromen-7-yl) hypoiodite is O=c1ccc2ccc(OI)cc2o1.
What is the InChIKey of (2-oxochromen-7-yl) hypoiodite?
The InChIKey is XHRVUGUREXCJEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5IO3/c10-13-7-3-1-6-2-4-9(11)12-8(6)5-7/h1-5H.
What are the key properties of (2-oxochromen-7-yl) hypoiodite?
(2-oxochromen-7-yl) hypoiodite has a molecular weight of 288.04 g/mol, XLogP of 2.52, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxochromen-7-yl) hypoiodite is sourced from PubChem (CID 138751183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).