About 7-ethynoxychromen-2-one
7-ethynoxychromen-2-one (PubChem CID 167427809) has the molecular formula C11H6O3
and a molecular weight of 186.17 g/mol. Its IUPAC name is 7-ethynoxychromen-2-one.
Molecular Properties
| Compound Name | 7-ethynoxychromen-2-one |
| PubChem CID | 167427809 |
| Molecular Formula | C11H6O3 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 7-ethynoxychromen-2-one |
| SMILES | C#COc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C11H6O3/c1-2-13-9-5-3-8-4-6-11(12)14-10(8)7-9/h1,3-7H |
| InChIKey | ZPVXABDQYDGDRJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-ethynoxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethynoxychromen-2-one?
The IUPAC name of 7-ethynoxychromen-2-one (CID 167427809) is 7-ethynoxychromen-2-one.
What is the SMILES notation for 7-ethynoxychromen-2-one?
The canonical SMILES for 7-ethynoxychromen-2-one is C#COc1ccc2ccc(=O)oc2c1.
What is the InChIKey of 7-ethynoxychromen-2-one?
The InChIKey is ZPVXABDQYDGDRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6O3/c1-2-13-9-5-3-8-4-6-11(12)14-10(8)7-9/h1,3-7H.
What are the key properties of 7-ethynoxychromen-2-one?
7-ethynoxychromen-2-one has a molecular weight of 186.17 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethynoxychromen-2-one is sourced from PubChem (CID 167427809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).