About potassium;hydride;7-(1,3-thiazol-2-yloxy)chromen-2-one
potassium;hydride;7-(1,3-thiazol-2-yloxy)chromen-2-one (PubChem CID 173089643) has the molecular formula C12H8KNO3S
and a molecular weight of 285.37 g/mol. Its IUPAC name is potassium;hydride;7-(1,3-thiazol-2-yloxy)chromen-2-one.
Molecular Properties
| Compound Name | potassium;hydride;7-(1,3-thiazol-2-yloxy)chromen-2-one |
| PubChem CID | 173089643 |
| Molecular Formula | C12H8KNO3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | potassium;hydride;7-(1,3-thiazol-2-yloxy)chromen-2-one |
| SMILES | O=c1ccc2ccc(Oc3nccs3)cc2o1.[H-].[K+] |
| InChI | InChI=1S/C12H7NO3S.K.H/c14-11-4-2-8-1-3-9(7-10(8)16-11)15-12-13-5-6-17-12;;/h1-7H;;/q;+1;-1 |
| InChIKey | JHZAILODGFXNAB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;7-(1,3-thiazol-2-yloxy)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;7-(1,3-thiazol-2-yloxy)chromen-2-one?
The IUPAC name of potassium;hydride;7-(1,3-thiazol-2-yloxy)chromen-2-one (CID 173089643) is potassium;hydride;7-(1,3-thiazol-2-yloxy)chromen-2-one.
What is the SMILES notation for potassium;hydride;7-(1,3-thiazol-2-yloxy)chromen-2-one?
The canonical SMILES for potassium;hydride;7-(1,3-thiazol-2-yloxy)chromen-2-one is O=c1ccc2ccc(Oc3nccs3)cc2o1.[H-].[K+].
What is the InChIKey of potassium;hydride;7-(1,3-thiazol-2-yloxy)chromen-2-one?
The InChIKey is JHZAILODGFXNAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7NO3S.K.H/c14-11-4-2-8-1-3-9(7-10(8)16-11)15-12-13-5-6-17-12;;/h1-7H;;/q;+1;-1.
What are the key properties of potassium;hydride;7-(1,3-thiazol-2-yloxy)chromen-2-one?
potassium;hydride;7-(1,3-thiazol-2-yloxy)chromen-2-one has a molecular weight of 285.37 g/mol, XLogP of 0.16, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;7-(1,3-thiazol-2-yloxy)chromen-2-one is sourced from PubChem (CID 173089643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).