C16H15NO3S — CID 38866745
7-[(2-propan-2-yl-1,3-thiazol-4-yl)methoxy]chromen-2-one (PubChem CID 38866745) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is 7-[(2-propan-2-yl-1,3-thiazol-4-yl)methoxy]chromen-2-one.
| Compound Name | 7-[(2-propan-2-yl-1,3-thiazol-4-yl)methoxy]chromen-2-one |
|---|---|
| PubChem CID | 38866745 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 7-[(2-propan-2-yl-1,3-thiazol-4-yl)methoxy]chromen-2-one |
| SMILES | CC(C)c1nc(COc2ccc3ccc(=O)oc3c2)cs1 |
| InChI | InChI=1S/C16H15NO3S/c1-10(2)16-17-12(9-21-16)8-19-13-5-3-11-4-6-15(18)20-14(11)7-13/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | JUUQTAPVOUTCBY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|