C16H14N2O3 — CID 89404478
7-[(3,5-diaminophenyl)methoxy]chromen-2-one (PubChem CID 89404478) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 7-[(3,5-diaminophenyl)methoxy]chromen-2-one.
| Compound Name | 7-[(3,5-diaminophenyl)methoxy]chromen-2-one |
|---|---|
| PubChem CID | 89404478 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 7-[(3,5-diaminophenyl)methoxy]chromen-2-one |
| SMILES | Nc1cc(N)cc(COc2ccc3ccc(=O)oc3c2)c1 |
| InChI | InChI=1S/C16H14N2O3/c17-12-5-10(6-13(18)7-12)9-20-14-3-1-11-2-4-16(19)21-15(11)8-14/h1-8H,9,17-18H2 |
| InChIKey | UNFVDNYUFBBDST-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|