C15H26O2Si — CID 141103584
[methyl-di(propan-2-yl)silyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 141103584) has the molecular formula C15H26O2Si and a molecular weight of 266.46 g/mol. Its IUPAC name is [methyl-di(propan-2-yl)silyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [methyl-di(propan-2-yl)silyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 141103584 |
| Molecular Formula | C15H26O2Si |
| Molecular Weight | 266.46 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | [methyl-di(propan-2-yl)silyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(C)[Si](C)(OC(=O)C1CC2C=CC1C2)C(C)C |
| InChI | InChI=1S/C15H26O2Si/c1-10(2)18(5,11(3)4)17-15(16)14-9-12-6-7-13(14)8-12/h6-7,10-14H,8-9H2,1-5H3 |
| InChIKey | BKUNFOWJPJOPHD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|