C29H50O8 — CID 70173445
bis[1,1-bis[(2-methylpropan-2-yl)oxy]ethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 70173445) has the molecular formula C29H50O8 and a molecular weight of 526.71 g/mol. Its IUPAC name is bis[1,1-bis[(2-methylpropan-2-yl)oxy]ethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | bis[1,1-bis[(2-methylpropan-2-yl)oxy]ethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 70173445 |
| Molecular Formula | C29H50O8 |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.35 |
| IUPAC Name | bis[1,1-bis[(2-methylpropan-2-yl)oxy]ethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CC(C)(C)OC(C)(OC(=O)C1C2C=CC(C2)C1C(=O)OC(C)(OC(C)(C)C)OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C29H50O8/c1-24(2,3)34-28(13,35-25(4,5)6)32-22(30)20-18-15-16-19(17-18)21(20)23(31)33-29(14,36-26(7,8)9)37-27(10,11)12/h15-16,18-21H,17H2,1-14H3 |
| InChIKey | ORPVBYLLZARRPY-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|