C9H8F3O2- — CID 152769128
3-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 152769128) has the molecular formula C9H8F3O2- and a molecular weight of 205.15 g/mol. Its IUPAC name is 3-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 3-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 152769128 |
| Molecular Formula | C9H8F3O2- |
| Molecular Weight | 205.15 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 3-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C([O-])C1C2C=CC(C2)C1C(F)(F)F |
| InChI | InChI=1S/C9H9F3O2/c10-9(11,12)7-5-2-1-4(3-5)6(7)8(13)14/h1-2,4-7H,3H2,(H,13,14)/p-1 |
| InChIKey | PZNNUYLEQUVQLC-UHFFFAOYSA-M |
| XLogP | 0.74 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.15 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|