C9H10NO3- — CID 7218088
(1S,2S,3S,4S)-3-carbamoylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 7218088) has the molecular formula C9H10NO3- and a molecular weight of 180.18 g/mol. Its IUPAC name is (1S,2S,3S,4S)-3-carbamoylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1S,2S,3S,4S)-3-carbamoylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 7218088 |
| Molecular Formula | C9H10NO3- |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | (1S,2S,3S,4S)-3-carbamoylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | NC(=O)[C@@H]1[C@@H](C(=O)[O-])[C@@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C9H11NO3/c10-8(11)6-4-1-2-5(3-4)7(6)9(12)13/h1-2,4-7H,3H2,(H2,10,11)(H,12,13)/p-1/t4-,5-,6+,7+/m1/s1 |
| InChIKey | JVBMCNHIFPWAOF-JWXFUTCRSA-M |
| XLogP | -1.34 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|